vclaar0180 vclaar0180

09-04-2020
Mathematics

contestada

Can someone check if this is right? simple probability but i am unsure if my answer

Can someone check if this is right simple probability but i am unsure if my answer class=

Respuesta :

randomperson100 randomperson100

09-04-2020

I think It is correct tbh

Answer Link

Otras preguntas

100pts!! Read the excerpt from "Lise Marie de Baissac.” According to her SOE file, "[s]he was the inspiration of groups on the Orne [river] and by her initiati

IUPAC NAME FOR:CH2(OH)-CH2-CH(C2H5)-OH

Which of the following best describes how the participant addresses an alternative viewpoint? Rachel cites a direct quotation to support her viewpoint that Suza

1. What are the attributes of a successful healthcare team?

Which word means ""an inflamed bowel""? myles is very focused. his can be intimidating. which word means ""clearing someone of blame""?

Question 3 Here are three more lines. What is the slope of the lines? 1 pts

Which statement correctly describes how a reader can identify character motivations? A. by supporting ideas with textual evidence and commentary that explains

the actual yield of a product in a reaction was measured as 2.80 g. if the theoretical yield of the product for the reaction is 3.12 g, what is the percentage y

Which research question is most effective? A. How did natural gas affect the ozone layer in 1975? B. How do fossil fuels affect the atmosphere? C. When were fos

Question 4 of 2 Which of the following practices was more likely to occur before the scientific revolution than after? O A. Political leaders funded private aca

good job